C32H20O3 — CID 98159614
(5S,12S,29R,33S)-31-oxanonacyclo[14.6.6.55,12.02,15.04,13.06,11.017,22.023,28.029,33]tritriaconta-2,4(13),6,8,10,14,17,19,21,23,25,27-dodecaene-30,32-dione (PubChem CID 98159614) has the molecular formula C32H20O3 and a molecular weight of 452.51 g/mol. Its IUPAC name is (5S,12S,29R,33S)-31-oxanonacyclo[14.6.6.55,12.02,15.04,13.06,11.017,22.023,28.029,33]tritriaconta-2,4(13),6,8,10,14,17,19,21,23,25,27-dodecaene-30,32-dione.
| Compound Name | (5S,12S,29R,33S)-31-oxanonacyclo[14.6.6.55,12.02,15.04,13.06,11.017,22.023,28.029,33]tritriaconta-2,4(13),6,8,10,14,17,19,21,23,25,27-dodecaene-30,32-dione |
|---|---|
| PubChem CID | 98159614 |
| Molecular Formula | C32H20O3 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | (5S,12S,29R,33S)-31-oxanonacyclo[14.6.6.55,12.02,15.04,13.06,11.017,22.023,28.029,33]tritriaconta-2,4(13),6,8,10,14,17,19,21,23,25,27-dodecaene-30,32-dione |
| SMILES | O=C1OC(=O)[C@H]2[C@H]3c4ccccc4[C@@H](c4cc5c(cc43)C3c4ccccc4C5c4ccccc43)[C@@H]12 |
| InChI | InChI=1S/C32H20O3/c33-31-29-27-19-11-5-6-12-20(19)28(30(29)32(34)35-31)24-14-22-21(13-23(24)27)25-15-7-1-2-8-16(15)26(22)18-10-4-3-9-17(18)25/h1-14,25-30H/t25?,26?,27-,28-,29-,30+/m0/s1 |
| InChIKey | GKTGYQBTOQNKNB-CSXACLAXSA-N |
| XLogP | 5.58 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|