C18H11ClO3 — CID 98268526
(15S,19R)-1-chloro-17-oxapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione (PubChem CID 98268526) has the molecular formula C18H11ClO3 and a molecular weight of 310.74 g/mol. Its IUPAC name is (15S,19R)-1-chloro-17-oxapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione.
| Compound Name | (15S,19R)-1-chloro-17-oxapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
|---|---|
| PubChem CID | 98268526 |
| Molecular Formula | C18H11ClO3 |
| Molecular Weight | 310.74 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | (15S,19R)-1-chloro-17-oxapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
| SMILES | O=C1OC(=O)[C@@H]2[C@H]1C1c3ccccc3C2(Cl)c2ccccc21 |
| InChI | InChI=1S/C18H11ClO3/c19-18-11-7-3-1-5-9(11)13(10-6-2-4-8-12(10)18)14-15(18)17(21)22-16(14)20/h1-8,13-15H/t13?,14-,15+,18?/m1/s1 |
| InChIKey | ZNVBZVTWIYFOBA-DGSCNEQVSA-N |
| XLogP | 2.94 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.74 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|