C27H22O4 — CID 102010030
1-[(1S)-1-phenylmethoxyethyl]-17-oxapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione (PubChem CID 102010030) has the molecular formula C27H22O4 and a molecular weight of 410.47 g/mol. Its IUPAC name is 1-[(1S)-1-phenylmethoxyethyl]-17-oxapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione.
| Compound Name | 1-[(1S)-1-phenylmethoxyethyl]-17-oxapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
|---|---|
| PubChem CID | 102010030 |
| Molecular Formula | C27H22O4 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | 1-[(1S)-1-phenylmethoxyethyl]-17-oxapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
| SMILES | C[C@H](OCc1ccccc1)C12c3ccccc3C(c3ccccc31)C1C(=O)OC(=O)C12 |
| InChI | InChI=1S/C27H22O4/c1-16(30-15-17-9-3-2-4-10-17)27-20-13-7-5-11-18(20)22(19-12-6-8-14-21(19)27)23-24(27)26(29)31-25(23)28/h2-14,16,22-24H,15H2,1H3/t16-,22?,23?,24?,27?/m0/s1 |
| InChIKey | HTGVKWFYLGCSKE-IORBVFHRSA-N |
| XLogP | 4.35 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|