C19H14O4 — CID 98539226
(1R,14R,15R,19S)-1-methoxy-17-oxapentacyclo[12.5.0.02,7.08,13.015,19]nonadeca-2,4,6,8,10,12-hexaene-16,18-dione (PubChem CID 98539226) has the molecular formula C19H14O4 and a molecular weight of 306.32 g/mol. Its IUPAC name is (1R,14R,15R,19S)-1-methoxy-17-oxapentacyclo[12.5.0.02,7.08,13.015,19]nonadeca-2,4,6,8,10,12-hexaene-16,18-dione.
| Compound Name | (1R,14R,15R,19S)-1-methoxy-17-oxapentacyclo[12.5.0.02,7.08,13.015,19]nonadeca-2,4,6,8,10,12-hexaene-16,18-dione |
|---|---|
| PubChem CID | 98539226 |
| Molecular Formula | C19H14O4 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | (1R,14R,15R,19S)-1-methoxy-17-oxapentacyclo[12.5.0.02,7.08,13.015,19]nonadeca-2,4,6,8,10,12-hexaene-16,18-dione |
| SMILES | CO[C@]12c3ccccc3-c3ccccc3[C@H]1[C@H]1C(=O)OC(=O)[C@@H]12 |
| InChI | InChI=1S/C19H14O4/c1-22-19-13-9-5-4-7-11(13)10-6-2-3-8-12(10)15(19)14-16(19)18(21)23-17(14)20/h2-9,14-16H,1H3/t14-,15+,16-,19-/m1/s1 |
| InChIKey | JVUYITYOPQCFKX-YYAJDYIMSA-N |
| XLogP | 2.62 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|