C22H20O4 — CID 102364638
1-(ethoxymethyl)-15-methyl-17-oxapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione (PubChem CID 102364638) has the molecular formula C22H20O4 and a molecular weight of 348.40 g/mol. Its IUPAC name is 1-(ethoxymethyl)-15-methyl-17-oxapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione.
| Compound Name | 1-(ethoxymethyl)-15-methyl-17-oxapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
|---|---|
| PubChem CID | 102364638 |
| Molecular Formula | C22H20O4 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 1-(ethoxymethyl)-15-methyl-17-oxapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
| SMILES | CCOCC12c3ccccc3C(c3ccccc31)C1C(=O)OC(=O)C12C |
| InChI | InChI=1S/C22H20O4/c1-3-25-12-22-15-10-6-4-8-13(15)17(14-9-5-7-11-16(14)22)18-19(23)26-20(24)21(18,22)2/h4-11,17-18H,3,12H2,1-2H3 |
| InChIKey | XLPFBYRKDZJSBS-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|