C18H15NO3 — CID 174491073
3-(9H-fluoren-9-yl)-3-methoxypyrrolidine-2,5-dione (PubChem CID 174491073) has the molecular formula C18H15NO3 and a molecular weight of 293.32 g/mol. Its IUPAC name is 3-(9H-fluoren-9-yl)-3-methoxypyrrolidine-2,5-dione.
| Compound Name | 3-(9H-fluoren-9-yl)-3-methoxypyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 174491073 |
| Molecular Formula | C18H15NO3 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | 3-(9H-fluoren-9-yl)-3-methoxypyrrolidine-2,5-dione |
| SMILES | COC1(C2c3ccccc3-c3ccccc32)CC(=O)NC1=O |
| InChI | InChI=1S/C18H15NO3/c1-22-18(10-15(20)19-17(18)21)16-13-8-4-2-6-11(13)12-7-3-5-9-14(12)16/h2-9,16H,10H2,1H3,(H,19,20,21) |
| InChIKey | TZQKVCPPDAFHIT-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|