C24H25NO4 — CID 175388554
9H-fluoren-9-ylmethyl 2,5-dioxo-3-pentylpyrrolidine-3-carboxylate (PubChem CID 175388554) has the molecular formula C24H25NO4 and a molecular weight of 391.47 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl 2,5-dioxo-3-pentylpyrrolidine-3-carboxylate.
| Compound Name | 9H-fluoren-9-ylmethyl 2,5-dioxo-3-pentylpyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 175388554 |
| Molecular Formula | C24H25NO4 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | 9H-fluoren-9-ylmethyl 2,5-dioxo-3-pentylpyrrolidine-3-carboxylate |
| SMILES | CCCCCC1(C(=O)OCC2c3ccccc3-c3ccccc32)CC(=O)NC1=O |
| InChI | InChI=1S/C24H25NO4/c1-2-3-8-13-24(14-21(26)25-22(24)27)23(28)29-15-20-18-11-6-4-9-16(18)17-10-5-7-12-19(17)20/h4-7,9-12,20H,2-3,8,13-15H2,1H3,(H,25,26,27) |
| InChIKey | VGNWNQLWLHNRLD-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|