C12H10N2O3 — CID 10263233
spiro[2,3-dihydroisoquinoline-4,3'-pyrrolidine]-1,2',5'-trione (PubChem CID 10263233) has the molecular formula C12H10N2O3 and a molecular weight of 230.22 g/mol. Its IUPAC name is spiro[2,3-dihydroisoquinoline-4,3'-pyrrolidine]-1,2',5'-trione.
| Compound Name | spiro[2,3-dihydroisoquinoline-4,3'-pyrrolidine]-1,2',5'-trione |
|---|---|
| PubChem CID | 10263233 |
| Molecular Formula | C12H10N2O3 |
| Molecular Weight | 230.22 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | spiro[2,3-dihydroisoquinoline-4,3'-pyrrolidine]-1,2',5'-trione |
| SMILES | O=C1CC2(CNC(=O)c3ccccc32)C(=O)N1 |
| InChI | InChI=1S/C12H10N2O3/c15-9-5-12(11(17)14-9)6-13-10(16)7-3-1-2-4-8(7)12/h1-4H,5-6H2,(H,13,16)(H,14,15,17) |
| InChIKey | WQEHOVFANOLJTQ-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.22 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|