C28H21NO3 — CID 24813481
(2E,5'E)-2,5'-dibenzylidenespiro[3H-naphthalene-4,3'-piperidine]-1,2',6'-trione (PubChem CID 24813481) has the molecular formula C28H21NO3 and a molecular weight of 419.48 g/mol. Its IUPAC name is (2E,5'E)-2,5'-dibenzylidenespiro[3H-naphthalene-4,3'-piperidine]-1,2',6'-trione.
| Compound Name | (2E,5'E)-2,5'-dibenzylidenespiro[3H-naphthalene-4,3'-piperidine]-1,2',6'-trione |
|---|---|
| PubChem CID | 24813481 |
| Molecular Formula | C28H21NO3 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | (2E,5'E)-2,5'-dibenzylidenespiro[3H-naphthalene-4,3'-piperidine]-1,2',6'-trione |
| SMILES | O=C1NC(=O)C2(C/C1=C\c1ccccc1)C/C(=C\c1ccccc1)C(=O)c1ccccc12 |
| InChI | InChI=1S/C28H21NO3/c30-25-21(15-19-9-3-1-4-10-19)17-28(24-14-8-7-13-23(24)25)18-22(26(31)29-27(28)32)16-20-11-5-2-6-12-20/h1-16H,17-18H2,(H,29,31,32)/b21-15+,22-16+ |
| InChIKey | JJMXQTRTLGSSOU-YHARCJFQSA-N |
| XLogP | 4.72 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|