C17H14O — CID 10399128
(4Z)-4-benzylidene-2,3-dihydronaphthalen-1-one (PubChem CID 10399128) has the molecular formula C17H14O and a molecular weight of 234.30 g/mol. Its IUPAC name is (4Z)-4-benzylidene-2,3-dihydronaphthalen-1-one.
| Compound Name | (4Z)-4-benzylidene-2,3-dihydronaphthalen-1-one |
|---|---|
| PubChem CID | 10399128 |
| Molecular Formula | C17H14O |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | (4Z)-4-benzylidene-2,3-dihydronaphthalen-1-one |
| SMILES | O=C1CC/C(=C/c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C17H14O/c18-17-11-10-14(12-13-6-2-1-3-7-13)15-8-4-5-9-16(15)17/h1-9,12H,10-11H2/b14-12- |
| InChIKey | DQWPPQQBPSWBIC-OWBHPGMISA-N |
| XLogP | 4.20 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|