C23H20O2 — CID 15315265
(3E,7E)-3,7-dibenzylidenebicyclo[3.3.1]nonane-2,6-dione (PubChem CID 15315265) has the molecular formula C23H20O2 and a molecular weight of 328.41 g/mol. Its IUPAC name is (3E,7E)-3,7-dibenzylidenebicyclo[3.3.1]nonane-2,6-dione.
| Compound Name | (3E,7E)-3,7-dibenzylidenebicyclo[3.3.1]nonane-2,6-dione |
|---|---|
| PubChem CID | 15315265 |
| Molecular Formula | C23H20O2 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | (3E,7E)-3,7-dibenzylidenebicyclo[3.3.1]nonane-2,6-dione |
| SMILES | O=C1/C(=C/c2ccccc2)CC2CC1C/C(=C\c1ccccc1)C2=O |
| InChI | InChI=1S/C23H20O2/c24-22-18(11-16-7-3-1-4-8-16)13-20-15-21(22)14-19(23(20)25)12-17-9-5-2-6-10-17/h1-12,20-21H,13-15H2/b18-11+,19-12+ |
| InChIKey | FLCVVWLVXUXRFP-GDAWTGGTSA-N |
| XLogP | 4.72 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|