C39H36O9 — CID 139204729
(1S,3E,5R)-3-benzylidene-6,8-dioxabicyclo[3.2.1]octan-4-one (PubChem CID 139204729) has the molecular formula C39H36O9 and a molecular weight of 648.71 g/mol. Its IUPAC name is (1S,3E,5R)-3-benzylidene-6,8-dioxabicyclo[3.2.1]octan-4-one.
| Compound Name | (1S,3E,5R)-3-benzylidene-6,8-dioxabicyclo[3.2.1]octan-4-one |
|---|---|
| PubChem CID | 139204729 |
| Molecular Formula | C39H36O9 |
| Molecular Weight | 648.71 g/mol |
| Exact Mass | 648.24 |
| IUPAC Name | (1S,3E,5R)-3-benzylidene-6,8-dioxabicyclo[3.2.1]octan-4-one |
| SMILES | O=C1/C(=C/c2ccccc2)C[C@H]2CO[C@@H]1O2.O=C1/C(=C/c2ccccc2)C[C@H]2CO[C@@H]1O2.O=C1/C(=C/c2ccccc2)C[C@H]2CO[C@@H]1O2 |
| InChI | InChI=1S/3C13H12O3/c3*14-12-10(6-9-4-2-1-3-5-9)7-11-8-15-13(12)16-11/h3*1-6,11,13H,7-8H2/b3*10-6+/t3*11-,13+/m000/s1 |
| InChIKey | YHLWVSGNJBGYNL-NUQSPPCWSA-N |
| XLogP | 5.35 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.71 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|