C19H16O2S2 — CID 915771
(1R,3Z,5R)-3,7-bis(thiophen-2-ylmethylidene)bicyclo[3.3.1]nonane-2,6-dione (PubChem CID 915771) has the molecular formula C19H16O2S2 and a molecular weight of 340.47 g/mol. Its IUPAC name is (1R,3Z,5R)-3,7-bis(thiophen-2-ylmethylidene)bicyclo[3.3.1]nonane-2,6-dione.
| Compound Name | (1R,3Z,5R)-3,7-bis(thiophen-2-ylmethylidene)bicyclo[3.3.1]nonane-2,6-dione |
|---|---|
| PubChem CID | 915771 |
| Molecular Formula | C19H16O2S2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | (1R,3Z,5R)-3,7-bis(thiophen-2-ylmethylidene)bicyclo[3.3.1]nonane-2,6-dione |
| SMILES | O=C1C(=Cc2cccs2)C[C@H]2C[C@@H]1C/C(=C/c1cccs1)C2=O |
| InChI | InChI=1S/C19H16O2S2/c20-18-13-7-12(8-14(18)10-16-3-1-5-22-16)19(21)15(9-13)11-17-4-2-6-23-17/h1-6,10-13H,7-9H2/b14-10-,15-11?/t12-,13-/m1/s1 |
| InChIKey | BPNRNVSTFMGATC-OCZGCJMLSA-N |
| XLogP | 4.84 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|