C15H18N2OS — CID 42917262
(2E,6E)-2-[(2E)-2-(dimethylhydrazinylidene)ethylidene]-6-(thiophen-2-ylmethylidene)cyclohexan-1-one (PubChem CID 42917262) has the molecular formula C15H18N2OS and a molecular weight of 274.39 g/mol. Its IUPAC name is (2E,6E)-2-[(2E)-2-(dimethylhydrazinylidene)ethylidene]-6-(thiophen-2-ylmethylidene)cyclohexan-1-one.
| Compound Name | (2E,6E)-2-[(2E)-2-(dimethylhydrazinylidene)ethylidene]-6-(thiophen-2-ylmethylidene)cyclohexan-1-one |
|---|---|
| PubChem CID | 42917262 |
| Molecular Formula | C15H18N2OS |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | (2E,6E)-2-[(2E)-2-(dimethylhydrazinylidene)ethylidene]-6-(thiophen-2-ylmethylidene)cyclohexan-1-one |
| SMILES | CN(C)/N=C/C=C1\CCC/C(=C\c2cccs2)C1=O |
| InChI | InChI=1S/C15H18N2OS/c1-17(2)16-9-8-12-5-3-6-13(15(12)18)11-14-7-4-10-19-14/h4,7-11H,3,5-6H2,1-2H3/b12-8+,13-11+,16-9+ |
| InChIKey | LITBGXNPIKNKFL-LAXUWTBTSA-N |
| XLogP | 3.36 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|