C20H27N3O — CID 6900584
(2Z,5E)-2-[[4-(diethylamino)phenyl]methylidene]-5-[(2Z)-2-(dimethylhydrazinylidene)ethylidene]cyclopentan-1-one (PubChem CID 6900584) has the molecular formula C20H27N3O and a molecular weight of 325.46 g/mol. Its IUPAC name is (2Z,5E)-2-[[4-(diethylamino)phenyl]methylidene]-5-[(2Z)-2-(dimethylhydrazinylidene)ethylidene]cyclopentan-1-one.
| Compound Name | (2Z,5E)-2-[[4-(diethylamino)phenyl]methylidene]-5-[(2Z)-2-(dimethylhydrazinylidene)ethylidene]cyclopentan-1-one |
|---|---|
| PubChem CID | 6900584 |
| Molecular Formula | C20H27N3O |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.22 |
| IUPAC Name | (2Z,5E)-2-[[4-(diethylamino)phenyl]methylidene]-5-[(2Z)-2-(dimethylhydrazinylidene)ethylidene]cyclopentan-1-one |
| SMILES | CCN(CC)c1ccc(/C=C2/CC/C(=C\C=N/N(C)C)C2=O)cc1 |
| InChI | InChI=1S/C20H27N3O/c1-5-23(6-2)19-11-7-16(8-12-19)15-18-10-9-17(20(18)24)13-14-21-22(3)4/h7-8,11-15H,5-6,9-10H2,1-4H3/b17-13+,18-15-,21-14- |
| InChIKey | LQJHPDKJVNVALZ-FYEAFEFSSA-N |
| XLogP | 3.75 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|