C29H38N2O — CID 2304864
(2Z,6E)-2,6-bis[[4-(diethylamino)phenyl]methylidene]-4-methylcyclohexan-1-one (PubChem CID 2304864) has the molecular formula C29H38N2O and a molecular weight of 430.64 g/mol. Its IUPAC name is (2Z,6E)-2,6-bis[[4-(diethylamino)phenyl]methylidene]-4-methylcyclohexan-1-one.
| Compound Name | (2Z,6E)-2,6-bis[[4-(diethylamino)phenyl]methylidene]-4-methylcyclohexan-1-one |
|---|---|
| PubChem CID | 2304864 |
| Molecular Formula | C29H38N2O |
| Molecular Weight | 430.64 g/mol |
| Exact Mass | 430.30 |
| IUPAC Name | (2Z,6E)-2,6-bis[[4-(diethylamino)phenyl]methylidene]-4-methylcyclohexan-1-one |
| SMILES | CCN(CC)c1ccc(/C=C2/CC(C)C/C(=C\c3ccc(N(CC)CC)cc3)C2=O)cc1 |
| InChI | InChI=1S/C29H38N2O/c1-6-30(7-2)27-14-10-23(11-15-27)20-25-18-22(5)19-26(29(25)32)21-24-12-16-28(17-13-24)31(8-3)9-4/h10-17,20-22H,6-9,18-19H2,1-5H3/b25-20-,26-21+ |
| InChIKey | SFXPLYOSNTZJFW-NTDJFUTDSA-N |
| XLogP | 6.84 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.64 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|