C25H30N2O — CID 20653368
(2Z,5Z)-2-[[4-(diethylamino)phenyl]methylidene]-5-[[4-(dimethylamino)phenyl]methylidene]cyclopentan-1-one (PubChem CID 20653368) has the molecular formula C25H30N2O and a molecular weight of 374.53 g/mol. Its IUPAC name is (2Z,5Z)-2-[[4-(diethylamino)phenyl]methylidene]-5-[[4-(dimethylamino)phenyl]methylidene]cyclopentan-1-one.
| Compound Name | (2Z,5Z)-2-[[4-(diethylamino)phenyl]methylidene]-5-[[4-(dimethylamino)phenyl]methylidene]cyclopentan-1-one |
|---|---|
| PubChem CID | 20653368 |
| Molecular Formula | C25H30N2O |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.24 |
| IUPAC Name | (2Z,5Z)-2-[[4-(diethylamino)phenyl]methylidene]-5-[[4-(dimethylamino)phenyl]methylidene]cyclopentan-1-one |
| SMILES | CCN(CC)c1ccc(/C=C2/CC/C(=C/c3ccc(N(C)C)cc3)C2=O)cc1 |
| InChI | InChI=1S/C25H30N2O/c1-5-27(6-2)24-15-9-20(10-16-24)18-22-12-11-21(25(22)28)17-19-7-13-23(14-8-19)26(3)4/h7-10,13-18H,5-6,11-12H2,1-4H3/b21-17-,22-18- |
| InChIKey | PHBFKQJTFYUMBU-SVJWQLCWSA-N |
| XLogP | 5.43 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|