C35H50N2O — CID 69436627
2,5-bis[[4-(dibutylamino)phenyl]methylidene]cyclopentan-1-one (PubChem CID 69436627) has the molecular formula C35H50N2O and a molecular weight of 514.80 g/mol. Its IUPAC name is 2,5-bis[[4-(dibutylamino)phenyl]methylidene]cyclopentan-1-one.
| Compound Name | 2,5-bis[[4-(dibutylamino)phenyl]methylidene]cyclopentan-1-one |
|---|---|
| PubChem CID | 69436627 |
| Molecular Formula | C35H50N2O |
| Molecular Weight | 514.80 g/mol |
| Exact Mass | 514.39 |
| IUPAC Name | 2,5-bis[[4-(dibutylamino)phenyl]methylidene]cyclopentan-1-one |
| SMILES | CCCCN(CCCC)c1ccc(C=C2CCC(=Cc3ccc(N(CCCC)CCCC)cc3)C2=O)cc1 |
| InChI | InChI=1S/C35H50N2O/c1-5-9-23-36(24-10-6-2)33-19-13-29(14-20-33)27-31-17-18-32(35(31)38)28-30-15-21-34(22-16-30)37(25-11-7-3)26-12-8-4/h13-16,19-22,27-28H,5-12,17-18,23-26H2,1-4H3 |
| InChIKey | FNBXEYQSBDXXNE-UHFFFAOYSA-N |
| XLogP | 9.33 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.80 |
| LogP ≤ 5 | 9.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|