C11H13NOS — CID 110540726
(3E)-1-methyl-3-(thiophen-2-ylmethylidene)piperidin-4-one (PubChem CID 110540726) has the molecular formula C11H13NOS and a molecular weight of 207.30 g/mol. Its IUPAC name is (3E)-1-methyl-3-(thiophen-2-ylmethylidene)piperidin-4-one.
| Compound Name | (3E)-1-methyl-3-(thiophen-2-ylmethylidene)piperidin-4-one |
|---|---|
| PubChem CID | 110540726 |
| Molecular Formula | C11H13NOS |
| Molecular Weight | 207.30 g/mol |
| Exact Mass | 207.07 |
| IUPAC Name | (3E)-1-methyl-3-(thiophen-2-ylmethylidene)piperidin-4-one |
| SMILES | CN1CCC(=O)/C(=C/c2cccs2)C1 |
| InChI | InChI=1S/C11H13NOS/c1-12-5-4-11(13)9(8-12)7-10-3-2-6-14-10/h2-3,6-7H,4-5,8H2,1H3/b9-7+ |
| InChIKey | RZQXXCNYOPTWTQ-VQHVLOKHSA-N |
| XLogP | 2.04 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.30 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|