C8H5NO2S — CID 175714790
4-(thiophen-2-ylmethylidene)-1,3-oxazol-5-one (PubChem CID 175714790) has the molecular formula C8H5NO2S and a molecular weight of 179.20 g/mol. Its IUPAC name is 4-(thiophen-2-ylmethylidene)-1,3-oxazol-5-one.
| Compound Name | 4-(thiophen-2-ylmethylidene)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 175714790 |
| Molecular Formula | C8H5NO2S |
| Molecular Weight | 179.20 g/mol |
| Exact Mass | 179.00 |
| IUPAC Name | 4-(thiophen-2-ylmethylidene)-1,3-oxazol-5-one |
| SMILES | O=C1OC=NC1=Cc1cccs1 |
| InChI | InChI=1S/C8H5NO2S/c10-8-7(9-5-11-8)4-6-2-1-3-12-6/h1-5H |
| InChIKey | SCPIOPXLHBNKFU-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.20 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|