C32H29NO3 — CID 24813629
(2E,5'E)-2,5'-bis[(4-ethylphenyl)methylidene]spiro[3H-naphthalene-4,3'-piperidine]-1,2',6'-trione (PubChem CID 24813629) has the molecular formula C32H29NO3 and a molecular weight of 475.59 g/mol. Its IUPAC name is (2E,5'E)-2,5'-bis[(4-ethylphenyl)methylidene]spiro[3H-naphthalene-4,3'-piperidine]-1,2',6'-trione.
| Compound Name | (2E,5'E)-2,5'-bis[(4-ethylphenyl)methylidene]spiro[3H-naphthalene-4,3'-piperidine]-1,2',6'-trione |
|---|---|
| PubChem CID | 24813629 |
| Molecular Formula | C32H29NO3 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.21 |
| IUPAC Name | (2E,5'E)-2,5'-bis[(4-ethylphenyl)methylidene]spiro[3H-naphthalene-4,3'-piperidine]-1,2',6'-trione |
| SMILES | CCc1ccc(/C=C2\CC3(C/C(=C\c4ccc(CC)cc4)C(=O)c4ccccc43)C(=O)NC2=O)cc1 |
| InChI | InChI=1S/C32H29NO3/c1-3-21-9-13-23(14-10-21)17-25-19-32(28-8-6-5-7-27(28)29(25)34)20-26(30(35)33-31(32)36)18-24-15-11-22(4-2)12-16-24/h5-18H,3-4,19-20H2,1-2H3,(H,33,35,36)/b25-17+,26-18+ |
| InChIKey | OIOFVGPGBITKQP-RPCRKUJJSA-N |
| XLogP | 5.85 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|