C17H20N2O — CID 102535373
(2E)-2-[(4-ethylphenyl)methylidene]-5-imidazolidin-2-ylidenecyclopentan-1-one (PubChem CID 102535373) has the molecular formula C17H20N2O and a molecular weight of 268.36 g/mol. Its IUPAC name is (2E)-2-[(4-ethylphenyl)methylidene]-5-imidazolidin-2-ylidenecyclopentan-1-one.
| Compound Name | (2E)-2-[(4-ethylphenyl)methylidene]-5-imidazolidin-2-ylidenecyclopentan-1-one |
|---|---|
| PubChem CID | 102535373 |
| Molecular Formula | C17H20N2O |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | (2E)-2-[(4-ethylphenyl)methylidene]-5-imidazolidin-2-ylidenecyclopentan-1-one |
| SMILES | CCc1ccc(/C=C2\CCC(=C3NCCN3)C2=O)cc1 |
| InChI | InChI=1S/C17H20N2O/c1-2-12-3-5-13(6-4-12)11-14-7-8-15(16(14)20)17-18-9-10-19-17/h3-6,11,18-19H,2,7-10H2,1H3/b14-11+ |
| InChIKey | CJBNKHWKEVYRNW-SDNWHVSQSA-N |
| XLogP | 2.40 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|