C19H14Cl2O — CID 694487
(2E)-2,5-bis[(4-chlorophenyl)methylidene]cyclopentan-1-one (PubChem CID 694487) has the molecular formula C19H14Cl2O and a molecular weight of 329.23 g/mol. Its IUPAC name is (2E)-2,5-bis[(4-chlorophenyl)methylidene]cyclopentan-1-one.
| Compound Name | (2E)-2,5-bis[(4-chlorophenyl)methylidene]cyclopentan-1-one |
|---|---|
| PubChem CID | 694487 |
| Molecular Formula | C19H14Cl2O |
| Molecular Weight | 329.23 g/mol |
| Exact Mass | 328.04 |
| IUPAC Name | (2E)-2,5-bis[(4-chlorophenyl)methylidene]cyclopentan-1-one |
| SMILES | O=C1C(=Cc2ccc(Cl)cc2)CC/C1=C\c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H14Cl2O/c20-17-7-1-13(2-8-17)11-15-5-6-16(19(15)22)12-14-3-9-18(21)10-4-14/h1-4,7-12H,5-6H2/b15-11+,16-12? |
| InChIKey | HOAWLEKLGGIUDF-XTZWMPCRSA-N |
| XLogP | 5.82 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.23 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|