C19H18N2O — CID 142412170
(2Z,5Z)-2,5-bis[(4-aminophenyl)methylidene]cyclopentan-1-one (PubChem CID 142412170) has the molecular formula C19H18N2O and a molecular weight of 290.37 g/mol. Its IUPAC name is (2Z,5Z)-2,5-bis[(4-aminophenyl)methylidene]cyclopentan-1-one.
| Compound Name | (2Z,5Z)-2,5-bis[(4-aminophenyl)methylidene]cyclopentan-1-one |
|---|---|
| PubChem CID | 142412170 |
| Molecular Formula | C19H18N2O |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | (2Z,5Z)-2,5-bis[(4-aminophenyl)methylidene]cyclopentan-1-one |
| SMILES | Nc1ccc(/C=C2/CC/C(=C/c3ccc(N)cc3)C2=O)cc1 |
| InChI | InChI=1S/C19H18N2O/c20-17-7-1-13(2-8-17)11-15-5-6-16(19(15)22)12-14-3-9-18(21)10-4-14/h1-4,7-12H,5-6,20-21H2/b15-11-,16-12- |
| InChIKey | DLQPDDLGAUKGFS-NFLUSIDLSA-N |
| XLogP | 3.68 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|