C24H24N2O — CID 144552315
(2E,6E)-2,6-bis[(E)-3-(4-aminophenyl)prop-2-enylidene]cyclohexan-1-one (PubChem CID 144552315) has the molecular formula C24H24N2O and a molecular weight of 356.47 g/mol. Its IUPAC name is (2E,6E)-2,6-bis[(E)-3-(4-aminophenyl)prop-2-enylidene]cyclohexan-1-one.
| Compound Name | (2E,6E)-2,6-bis[(E)-3-(4-aminophenyl)prop-2-enylidene]cyclohexan-1-one |
|---|---|
| PubChem CID | 144552315 |
| Molecular Formula | C24H24N2O |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.19 |
| IUPAC Name | (2E,6E)-2,6-bis[(E)-3-(4-aminophenyl)prop-2-enylidene]cyclohexan-1-one |
| SMILES | Nc1ccc(/C=C/C=C2\CCC/C(=C\C=C\c3ccc(N)cc3)C2=O)cc1 |
| InChI | InChI=1S/C24H24N2O/c25-22-14-10-18(11-15-22)4-1-6-20-8-3-9-21(24(20)27)7-2-5-19-12-16-23(26)17-13-19/h1-2,4-7,10-17H,3,8-9,25-26H2/b4-1+,5-2+,20-6+,21-7+ |
| InChIKey | BUYOJACLLCKEJK-DYRCXTJASA-N |
| XLogP | 5.18 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|