C31H34N2O — CID 172844935
2,5-bis[5-[4-(dimethylamino)phenyl]penta-2,4-dienylidene]cyclopentan-1-one (PubChem CID 172844935) has the molecular formula C31H34N2O and a molecular weight of 450.63 g/mol. Its IUPAC name is 2,5-bis[5-[4-(dimethylamino)phenyl]penta-2,4-dienylidene]cyclopentan-1-one.
| Compound Name | 2,5-bis[5-[4-(dimethylamino)phenyl]penta-2,4-dienylidene]cyclopentan-1-one |
|---|---|
| PubChem CID | 172844935 |
| Molecular Formula | C31H34N2O |
| Molecular Weight | 450.63 g/mol |
| Exact Mass | 450.27 |
| IUPAC Name | 2,5-bis[5-[4-(dimethylamino)phenyl]penta-2,4-dienylidene]cyclopentan-1-one |
| SMILES | CN(C)c1ccc(C=CC=CC=C2CCC(=CC=CC=Cc3ccc(N(C)C)cc3)C2=O)cc1 |
| InChI | InChI=1S/C31H34N2O/c1-32(2)29-21-15-25(16-22-29)11-7-5-9-13-27-19-20-28(31(27)34)14-10-6-8-12-26-17-23-30(24-18-26)33(3)4/h5-18,21-24H,19-20H2,1-4H3 |
| InChIKey | XHEOUOOHSQSABH-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.63 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|