C23H20O — CID 42545090
(2Z,5E)-2,5-bis[(Z)-3-phenylprop-2-enylidene]cyclopentan-1-one (PubChem CID 42545090) has the molecular formula C23H20O and a molecular weight of 312.41 g/mol. Its IUPAC name is (2Z,5E)-2,5-bis[(Z)-3-phenylprop-2-enylidene]cyclopentan-1-one.
| Compound Name | (2Z,5E)-2,5-bis[(Z)-3-phenylprop-2-enylidene]cyclopentan-1-one |
|---|---|
| PubChem CID | 42545090 |
| Molecular Formula | C23H20O |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | (2Z,5E)-2,5-bis[(Z)-3-phenylprop-2-enylidene]cyclopentan-1-one |
| SMILES | O=C1/C(=C\C=C/c2ccccc2)CC/C1=C\C=C/c1ccccc1 |
| InChI | InChI=1S/C23H20O/c24-23-21(15-7-13-19-9-3-1-4-10-19)17-18-22(23)16-8-14-20-11-5-2-6-12-20/h1-16H,17-18H2/b13-7-,14-8-,21-15-,22-16+ |
| InChIKey | QMOAOGJBIBSQOO-BNPRWQMMSA-N |
| XLogP | 5.63 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|