C18H15NO — CID 130185154
(3E)-3-[(E)-3-phenylprop-2-enylidene]-1,4-dihydroquinolin-2-one (PubChem CID 130185154) has the molecular formula C18H15NO and a molecular weight of 261.32 g/mol. Its IUPAC name is (3E)-3-[(E)-3-phenylprop-2-enylidene]-1,4-dihydroquinolin-2-one.
| Compound Name | (3E)-3-[(E)-3-phenylprop-2-enylidene]-1,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 130185154 |
| Molecular Formula | C18H15NO |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | (3E)-3-[(E)-3-phenylprop-2-enylidene]-1,4-dihydroquinolin-2-one |
| SMILES | O=C1Nc2ccccc2C/C1=C\C=C\c1ccccc1 |
| InChI | InChI=1S/C18H15NO/c20-18-16(11-6-9-14-7-2-1-3-8-14)13-15-10-4-5-12-17(15)19-18/h1-12H,13H2,(H,19,20)/b9-6+,16-11+ |
| InChIKey | JHXJDFMJYPDISY-KCJIIOMUSA-N |
| XLogP | 3.82 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|