C25H26N2O2 — CID 24900048
(3E)-3-[[4-[(E)-3-(azepan-1-yl)-3-oxoprop-1-enyl]phenyl]methylidene]-1,4-dihydroquinolin-2-one (PubChem CID 24900048) has the molecular formula C25H26N2O2 and a molecular weight of 386.50 g/mol. Its IUPAC name is (3E)-3-[[4-[(E)-3-(azepan-1-yl)-3-oxoprop-1-enyl]phenyl]methylidene]-1,4-dihydroquinolin-2-one.
| Compound Name | (3E)-3-[[4-[(E)-3-(azepan-1-yl)-3-oxoprop-1-enyl]phenyl]methylidene]-1,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 24900048 |
| Molecular Formula | C25H26N2O2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | (3E)-3-[[4-[(E)-3-(azepan-1-yl)-3-oxoprop-1-enyl]phenyl]methylidene]-1,4-dihydroquinolin-2-one |
| SMILES | O=C1Nc2ccccc2C/C1=C\c1ccc(/C=C/C(=O)N2CCCCCC2)cc1 |
| InChI | InChI=1S/C25H26N2O2/c28-24(27-15-5-1-2-6-16-27)14-13-19-9-11-20(12-10-19)17-22-18-21-7-3-4-8-23(21)26-25(22)29/h3-4,7-14,17H,1-2,5-6,15-16,18H2,(H,26,29)/b14-13+,22-17+ |
| InChIKey | YPFDVBBIUOYRAV-LWEGYUNWSA-N |
| XLogP | 4.68 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|