C14H10BrNOS — CID 143664923
(3E)-3-[(4-bromothiophen-2-yl)methylidene]-1,4-dihydroquinolin-2-one (PubChem CID 143664923) has the molecular formula C14H10BrNOS and a molecular weight of 320.21 g/mol. Its IUPAC name is (3E)-3-[(4-bromothiophen-2-yl)methylidene]-1,4-dihydroquinolin-2-one.
| Compound Name | (3E)-3-[(4-bromothiophen-2-yl)methylidene]-1,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 143664923 |
| Molecular Formula | C14H10BrNOS |
| Molecular Weight | 320.21 g/mol |
| Exact Mass | 318.97 |
| IUPAC Name | (3E)-3-[(4-bromothiophen-2-yl)methylidene]-1,4-dihydroquinolin-2-one |
| SMILES | O=C1Nc2ccccc2C/C1=C\c1cc(Br)cs1 |
| InChI | InChI=1S/C14H10BrNOS/c15-11-7-12(18-8-11)6-10-5-9-3-1-2-4-13(9)16-14(10)17/h1-4,6-8H,5H2,(H,16,17)/b10-6+ |
| InChIKey | DIPBXDZWGYXMSF-UXBLZVDNSA-N |
| XLogP | 4.09 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.21 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|