C25H24O — CID 92533937
(2E,7E)-2,7-bis[(Z)-3-phenylprop-2-enylidene]cycloheptan-1-one (PubChem CID 92533937) has the molecular formula C25H24O and a molecular weight of 340.47 g/mol. Its IUPAC name is (2E,7E)-2,7-bis[(Z)-3-phenylprop-2-enylidene]cycloheptan-1-one.
| Compound Name | (2E,7E)-2,7-bis[(Z)-3-phenylprop-2-enylidene]cycloheptan-1-one |
|---|---|
| PubChem CID | 92533937 |
| Molecular Formula | C25H24O |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | (2E,7E)-2,7-bis[(Z)-3-phenylprop-2-enylidene]cycloheptan-1-one |
| SMILES | O=C1/C(=C/C=C\c2ccccc2)CCCC/C1=C\C=C/c1ccccc1 |
| InChI | InChI=1S/C25H24O/c26-25-23(19-9-15-21-11-3-1-4-12-21)17-7-8-18-24(25)20-10-16-22-13-5-2-6-14-22/h1-6,9-16,19-20H,7-8,17-18H2/b15-9-,16-10-,23-19+,24-20+ |
| InChIKey | ONORUXCYOUKTBD-XOUSOTBQSA-N |
| XLogP | 6.41 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|