C26H25NO3 — CID 1283579
ethyl 3,5-dicinnamylidene-4-oxopiperidine-1-carboxylate (PubChem CID 1283579) has the molecular formula C26H25NO3 and a molecular weight of 399.49 g/mol. Its IUPAC name is ethyl 3,5-dicinnamylidene-4-oxopiperidine-1-carboxylate.
| Compound Name | ethyl 3,5-dicinnamylidene-4-oxopiperidine-1-carboxylate |
|---|---|
| PubChem CID | 1283579 |
| Molecular Formula | C26H25NO3 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | ethyl 3,5-dicinnamylidene-4-oxopiperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CC(=CC=Cc2ccccc2)C(=O)C(=CC=Cc2ccccc2)C1 |
| InChI | InChI=1S/C26H25NO3/c1-2-30-26(29)27-19-23(17-9-15-21-11-5-3-6-12-21)25(28)24(20-27)18-10-16-22-13-7-4-8-14-22/h3-18H,2,19-20H2,1H3 |
| InChIKey | NWBSQXMNQUHANJ-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|