C18H18OS2 — CID 78146457
2-cinnamylidene-5-(1,3-dithian-2-ylidene)cyclopentan-1-one (PubChem CID 78146457) has the molecular formula C18H18OS2 and a molecular weight of 314.47 g/mol. Its IUPAC name is 2-cinnamylidene-5-(1,3-dithian-2-ylidene)cyclopentan-1-one.
| Compound Name | 2-cinnamylidene-5-(1,3-dithian-2-ylidene)cyclopentan-1-one |
|---|---|
| PubChem CID | 78146457 |
| Molecular Formula | C18H18OS2 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | 2-cinnamylidene-5-(1,3-dithian-2-ylidene)cyclopentan-1-one |
| SMILES | O=C1C(=CC=Cc2ccccc2)CCC1=C1SCCCS1 |
| InChI | InChI=1S/C18H18OS2/c19-17-15(9-4-8-14-6-2-1-3-7-14)10-11-16(17)18-20-12-5-13-21-18/h1-4,6-9H,5,10-13H2 |
| InChIKey | KWBQJNTZNQPXIW-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|