C13H12O2S2 — CID 821633
(5Z)-2-(1,3-dithiolan-2-ylidene)-5-(furan-2-ylmethylidene)cyclopentan-1-one (PubChem CID 821633) has the molecular formula C13H12O2S2 and a molecular weight of 264.37 g/mol. Its IUPAC name is (5Z)-2-(1,3-dithiolan-2-ylidene)-5-(furan-2-ylmethylidene)cyclopentan-1-one.
| Compound Name | (5Z)-2-(1,3-dithiolan-2-ylidene)-5-(furan-2-ylmethylidene)cyclopentan-1-one |
|---|---|
| PubChem CID | 821633 |
| Molecular Formula | C13H12O2S2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.03 |
| IUPAC Name | (5Z)-2-(1,3-dithiolan-2-ylidene)-5-(furan-2-ylmethylidene)cyclopentan-1-one |
| SMILES | O=C1C(=C2SCCS2)CC/C1=C/c1ccco1 |
| InChI | InChI=1S/C13H12O2S2/c14-12-9(8-10-2-1-5-15-10)3-4-11(12)13-16-6-7-17-13/h1-2,5,8H,3-4,6-7H2/b9-8- |
| InChIKey | OPFICVSKLZYRML-HJWRWDBZSA-N |
| XLogP | 3.72 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|