C13H16O2 — CID 177443971
(2Z)-2-(furan-2-ylmethylidene)cyclooctan-1-one (PubChem CID 177443971) has the molecular formula C13H16O2 and a molecular weight of 204.27 g/mol. Its IUPAC name is (2Z)-2-(furan-2-ylmethylidene)cyclooctan-1-one.
| Compound Name | (2Z)-2-(furan-2-ylmethylidene)cyclooctan-1-one |
|---|---|
| PubChem CID | 177443971 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | (2Z)-2-(furan-2-ylmethylidene)cyclooctan-1-one |
| SMILES | O=C1CCCCCC/C1=C/c1ccco1 |
| InChI | InChI=1S/C13H16O2/c14-13-8-4-2-1-3-6-11(13)10-12-7-5-9-15-12/h5,7,9-10H,1-4,6,8H2/b11-10- |
| InChIKey | RQXCJBSUMKSUKU-KHPPLWFESA-N |
| XLogP | 3.59 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|