C15H17NO3 — CID 101108134
(7E)-7-(furan-2-ylmethylidene)-4-methyl-2-azaspiro[4.5]decane-1,6-dione (PubChem CID 101108134) has the molecular formula C15H17NO3 and a molecular weight of 259.30 g/mol. Its IUPAC name is (7E)-7-(furan-2-ylmethylidene)-4-methyl-2-azaspiro[4.5]decane-1,6-dione.
| Compound Name | (7E)-7-(furan-2-ylmethylidene)-4-methyl-2-azaspiro[4.5]decane-1,6-dione |
|---|---|
| PubChem CID | 101108134 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | (7E)-7-(furan-2-ylmethylidene)-4-methyl-2-azaspiro[4.5]decane-1,6-dione |
| SMILES | CC1CNC(=O)C12CCC/C(=C\c1ccco1)C2=O |
| InChI | InChI=1S/C15H17NO3/c1-10-9-16-14(18)15(10)6-2-4-11(13(15)17)8-12-5-3-7-19-12/h3,5,7-8,10H,2,4,6,9H2,1H3,(H,16,18)/b11-8+ |
| InChIKey | COKYDWDSUDZDNT-DHZHZOJOSA-N |
| XLogP | 2.17 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|