C19H24O — CID 68643049
(2E)-2-[(2-cyclohexylphenyl)methylidene]cyclohexan-1-one (PubChem CID 68643049) has the molecular formula C19H24O and a molecular weight of 268.40 g/mol. Its IUPAC name is (2E)-2-[(2-cyclohexylphenyl)methylidene]cyclohexan-1-one.
| Compound Name | (2E)-2-[(2-cyclohexylphenyl)methylidene]cyclohexan-1-one |
|---|---|
| PubChem CID | 68643049 |
| Molecular Formula | C19H24O |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | (2E)-2-[(2-cyclohexylphenyl)methylidene]cyclohexan-1-one |
| SMILES | O=C1CCCC/C1=C\c1ccccc1C1CCCCC1 |
| InChI | InChI=1S/C19H24O/c20-19-13-7-5-11-17(19)14-16-10-4-6-12-18(16)15-8-2-1-3-9-15/h4,6,10,12,14-15H,1-3,5,7-9,11,13H2/b17-14+ |
| InChIKey | KTSLHMXBOORQOH-SAPNQHFASA-N |
| XLogP | 5.26 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|