About 2-cyclodecylbenzaldehyde
2-cyclodecylbenzaldehyde (PubChem CID 142358507) has the molecular formula C17H24O
and a molecular weight of 244.38 g/mol. Its IUPAC name is 2-cyclodecylbenzaldehyde.
Molecular Properties
| Compound Name | 2-cyclodecylbenzaldehyde |
| PubChem CID | 142358507 |
| Molecular Formula | C17H24O |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | 2-cyclodecylbenzaldehyde |
| SMILES | O=Cc1ccccc1C1CCCCCCCCC1 |
| InChI | InChI=1S/C17H24O/c18-14-16-12-8-9-13-17(16)15-10-6-4-2-1-3-5-7-11-15/h8-9,12-15H,1-7,10-11H2 |
| InChIKey | OAOSKQNYDDTBDP-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclodecylbenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclodecylbenzaldehyde?
The IUPAC name of 2-cyclodecylbenzaldehyde (CID 142358507) is 2-cyclodecylbenzaldehyde.
What is the SMILES notation for 2-cyclodecylbenzaldehyde?
The canonical SMILES for 2-cyclodecylbenzaldehyde is O=Cc1ccccc1C1CCCCCCCCC1.
What is the InChIKey of 2-cyclodecylbenzaldehyde?
The InChIKey is OAOSKQNYDDTBDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24O/c18-14-16-12-8-9-13-17(16)15-10-6-4-2-1-3-5-7-11-15/h8-9,12-15H,1-7,10-11H2.
What are the key properties of 2-cyclodecylbenzaldehyde?
2-cyclodecylbenzaldehyde has a molecular weight of 244.38 g/mol, XLogP of 5.11, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclodecylbenzaldehyde is sourced from PubChem (CID 142358507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).