C26H26O5 — CID 20842383
(2E,6Z)-2,6-bis[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enylidene]cyclohexan-1-one (PubChem CID 20842383) has the molecular formula C26H26O5 and a molecular weight of 418.49 g/mol. Its IUPAC name is (2E,6Z)-2,6-bis[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enylidene]cyclohexan-1-one.
| Compound Name | (2E,6Z)-2,6-bis[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enylidene]cyclohexan-1-one |
|---|---|
| PubChem CID | 20842383 |
| Molecular Formula | C26H26O5 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | (2E,6Z)-2,6-bis[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enylidene]cyclohexan-1-one |
| SMILES | COc1cc(/C=C/C=C2/CCC/C(=C\C=C\c3ccc(O)c(OC)c3)C2=O)ccc1O |
| InChI | InChI=1S/C26H26O5/c1-30-24-16-18(12-14-22(24)27)6-3-8-20-10-5-11-21(26(20)29)9-4-7-19-13-15-23(28)25(17-19)31-2/h3-4,6-9,12-17,27-28H,5,10-11H2,1-2H3/b6-3+,7-4+,20-8-,21-9+ |
| InChIKey | QTCFGIPIXZIJHC-VJURVTHGSA-N |
| XLogP | 5.45 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|