C19H14Cl2O3S — CID 124635641
(3Z,5Z)-3,5-bis[(4-chlorophenyl)methylidene]-1,1-dioxothian-4-one (PubChem CID 124635641) has the molecular formula C19H14Cl2O3S and a molecular weight of 393.29 g/mol. Its IUPAC name is (3Z,5Z)-3,5-bis[(4-chlorophenyl)methylidene]-1,1-dioxothian-4-one.
| Compound Name | (3Z,5Z)-3,5-bis[(4-chlorophenyl)methylidene]-1,1-dioxothian-4-one |
|---|---|
| PubChem CID | 124635641 |
| Molecular Formula | C19H14Cl2O3S |
| Molecular Weight | 393.29 g/mol |
| Exact Mass | 392.00 |
| IUPAC Name | (3Z,5Z)-3,5-bis[(4-chlorophenyl)methylidene]-1,1-dioxothian-4-one |
| SMILES | O=C1/C(=C/c2ccc(Cl)cc2)CS(=O)(=O)C/C1=C\c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H14Cl2O3S/c20-17-5-1-13(2-6-17)9-15-11-25(23,24)12-16(19(15)22)10-14-3-7-18(21)8-4-14/h1-10H,11-12H2/b15-9+,16-10+ |
| InChIKey | NHHGMJFIZMHSKP-KAVGSWPWSA-N |
| XLogP | 4.46 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.29 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|