C16H10ClFO3S — CID 17410689
(3E)-3-[(4-chlorophenyl)methylidene]-6-fluoro-1,1-dioxothiochromen-4-one (PubChem CID 17410689) has the molecular formula C16H10ClFO3S and a molecular weight of 336.77 g/mol. Its IUPAC name is (3E)-3-[(4-chlorophenyl)methylidene]-6-fluoro-1,1-dioxothiochromen-4-one.
| Compound Name | (3E)-3-[(4-chlorophenyl)methylidene]-6-fluoro-1,1-dioxothiochromen-4-one |
|---|---|
| PubChem CID | 17410689 |
| Molecular Formula | C16H10ClFO3S |
| Molecular Weight | 336.77 g/mol |
| Exact Mass | 336.00 |
| IUPAC Name | (3E)-3-[(4-chlorophenyl)methylidene]-6-fluoro-1,1-dioxothiochromen-4-one |
| SMILES | O=C1/C(=C\c2ccc(Cl)cc2)CS(=O)(=O)c2ccc(F)cc21 |
| InChI | InChI=1S/C16H10ClFO3S/c17-12-3-1-10(2-4-12)7-11-9-22(20,21)15-6-5-13(18)8-14(15)16(11)19/h1-8H,9H2/b11-7- |
| InChIKey | VJDQJJPEDONTCW-XFFZJAGNSA-N |
| XLogP | 3.53 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.77 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|