C19H13FN2O3S — CID 39967681
(3E)-6-fluoro-1,1-dioxo-3-[(1-phenylpyrazol-4-yl)methylidene]thiochromen-4-one (PubChem CID 39967681) has the molecular formula C19H13FN2O3S and a molecular weight of 368.39 g/mol. Its IUPAC name is (3E)-6-fluoro-1,1-dioxo-3-[(1-phenylpyrazol-4-yl)methylidene]thiochromen-4-one.
| Compound Name | (3E)-6-fluoro-1,1-dioxo-3-[(1-phenylpyrazol-4-yl)methylidene]thiochromen-4-one |
|---|---|
| PubChem CID | 39967681 |
| Molecular Formula | C19H13FN2O3S |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | (3E)-6-fluoro-1,1-dioxo-3-[(1-phenylpyrazol-4-yl)methylidene]thiochromen-4-one |
| SMILES | O=C1/C(=C\c2cnn(-c3ccccc3)c2)CS(=O)(=O)c2ccc(F)cc21 |
| InChI | InChI=1S/C19H13FN2O3S/c20-15-6-7-18-17(9-15)19(23)14(12-26(18,24)25)8-13-10-21-22(11-13)16-4-2-1-3-5-16/h1-11H,12H2/b14-8- |
| InChIKey | FSKFPGYTGBRBER-ZSOIEALJSA-N |
| XLogP | 3.07 |
| TPSA | 69.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|