C21H21FO4S — CID 6212299
(3E)-6-fluoro-3-[[4-(3-methylbutoxy)phenyl]methylidene]-1,1-dioxothiochromen-4-one (PubChem CID 6212299) has the molecular formula C21H21FO4S and a molecular weight of 388.46 g/mol. Its IUPAC name is (3E)-6-fluoro-3-[[4-(3-methylbutoxy)phenyl]methylidene]-1,1-dioxothiochromen-4-one.
| Compound Name | (3E)-6-fluoro-3-[[4-(3-methylbutoxy)phenyl]methylidene]-1,1-dioxothiochromen-4-one |
|---|---|
| PubChem CID | 6212299 |
| Molecular Formula | C21H21FO4S |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | (3E)-6-fluoro-3-[[4-(3-methylbutoxy)phenyl]methylidene]-1,1-dioxothiochromen-4-one |
| SMILES | CC(C)CCOc1ccc(/C=C2/CS(=O)(=O)c3ccc(F)cc3C2=O)cc1 |
| InChI | InChI=1S/C21H21FO4S/c1-14(2)9-10-26-18-6-3-15(4-7-18)11-16-13-27(24,25)20-8-5-17(22)12-19(20)21(16)23/h3-8,11-12,14H,9-10,13H2,1-2H3/b16-11- |
| InChIKey | GJDOXWVYBKZSER-WJDWOHSUSA-N |
| XLogP | 4.30 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|