C22H23FO3S — CID 7945746
(3Z)-6-fluoro-3-[[3-methoxy-4-(3-methylbutoxy)phenyl]methylidene]thiochromen-4-one (PubChem CID 7945746) has the molecular formula C22H23FO3S and a molecular weight of 386.49 g/mol. Its IUPAC name is (3Z)-6-fluoro-3-[[3-methoxy-4-(3-methylbutoxy)phenyl]methylidene]thiochromen-4-one.
| Compound Name | (3Z)-6-fluoro-3-[[3-methoxy-4-(3-methylbutoxy)phenyl]methylidene]thiochromen-4-one |
|---|---|
| PubChem CID | 7945746 |
| Molecular Formula | C22H23FO3S |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | (3Z)-6-fluoro-3-[[3-methoxy-4-(3-methylbutoxy)phenyl]methylidene]thiochromen-4-one |
| SMILES | COc1cc(/C=C2\CSc3ccc(F)cc3C2=O)ccc1OCCC(C)C |
| InChI | InChI=1S/C22H23FO3S/c1-14(2)8-9-26-19-6-4-15(11-20(19)25-3)10-16-13-27-21-7-5-17(23)12-18(21)22(16)24/h4-7,10-12,14H,8-9,13H2,1-3H3/b16-10+ |
| InChIKey | VTAMZCAIKBNNNK-MHWRWJLKSA-N |
| XLogP | 5.63 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|