C20H16FNO4 — CID 24650441
2-[4-[(E)-(7-fluoro-5-oxo-2,3-dihydro-1-benzoxepin-4-ylidene)methyl]-2-methoxyphenoxy]acetonitrile (PubChem CID 24650441) has the molecular formula C20H16FNO4 and a molecular weight of 353.35 g/mol. Its IUPAC name is 2-[4-[(E)-(7-fluoro-5-oxo-2,3-dihydro-1-benzoxepin-4-ylidene)methyl]-2-methoxyphenoxy]acetonitrile.
| Compound Name | 2-[4-[(E)-(7-fluoro-5-oxo-2,3-dihydro-1-benzoxepin-4-ylidene)methyl]-2-methoxyphenoxy]acetonitrile |
|---|---|
| PubChem CID | 24650441 |
| Molecular Formula | C20H16FNO4 |
| Molecular Weight | 353.35 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | 2-[4-[(E)-(7-fluoro-5-oxo-2,3-dihydro-1-benzoxepin-4-ylidene)methyl]-2-methoxyphenoxy]acetonitrile |
| SMILES | COc1cc(/C=C2\CCOc3ccc(F)cc3C2=O)ccc1OCC#N |
| InChI | InChI=1S/C20H16FNO4/c1-24-19-11-13(2-4-18(19)26-9-7-22)10-14-6-8-25-17-5-3-15(21)12-16(17)20(14)23/h2-5,10-12H,6,8-9H2,1H3/b14-10+ |
| InChIKey | CHZWLQNZKXMFFD-GXDHUFHOSA-N |
| XLogP | 3.79 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.35 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|