C18H15FO4 — CID 94189241
(4Z)-7-fluoro-4-[(3-hydroxy-4-methoxyphenyl)methylidene]-2,3-dihydro-1-benzoxepin-5-one (PubChem CID 94189241) has the molecular formula C18H15FO4 and a molecular weight of 314.31 g/mol. Its IUPAC name is (4Z)-7-fluoro-4-[(3-hydroxy-4-methoxyphenyl)methylidene]-2,3-dihydro-1-benzoxepin-5-one.
| Compound Name | (4Z)-7-fluoro-4-[(3-hydroxy-4-methoxyphenyl)methylidene]-2,3-dihydro-1-benzoxepin-5-one |
|---|---|
| PubChem CID | 94189241 |
| Molecular Formula | C18H15FO4 |
| Molecular Weight | 314.31 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | (4Z)-7-fluoro-4-[(3-hydroxy-4-methoxyphenyl)methylidene]-2,3-dihydro-1-benzoxepin-5-one |
| SMILES | COc1ccc(/C=C2/CCOc3ccc(F)cc3C2=O)cc1O |
| InChI | InChI=1S/C18H15FO4/c1-22-17-4-2-11(9-15(17)20)8-12-6-7-23-16-5-3-13(19)10-14(16)18(12)21/h2-5,8-10,20H,6-7H2,1H3/b12-8- |
| InChIKey | JXGMAFZOKDPASD-WQLSENKSSA-N |
| XLogP | 3.59 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.31 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|