C20H19FO4 — CID 24650439
(4E)-4-[(3-ethoxy-4-methoxyphenyl)methylidene]-7-fluoro-2,3-dihydro-1-benzoxepin-5-one (PubChem CID 24650439) has the molecular formula C20H19FO4 and a molecular weight of 342.37 g/mol. Its IUPAC name is (4E)-4-[(3-ethoxy-4-methoxyphenyl)methylidene]-7-fluoro-2,3-dihydro-1-benzoxepin-5-one.
| Compound Name | (4E)-4-[(3-ethoxy-4-methoxyphenyl)methylidene]-7-fluoro-2,3-dihydro-1-benzoxepin-5-one |
|---|---|
| PubChem CID | 24650439 |
| Molecular Formula | C20H19FO4 |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | (4E)-4-[(3-ethoxy-4-methoxyphenyl)methylidene]-7-fluoro-2,3-dihydro-1-benzoxepin-5-one |
| SMILES | CCOc1cc(/C=C2\CCOc3ccc(F)cc3C2=O)ccc1OC |
| InChI | InChI=1S/C20H19FO4/c1-3-24-19-11-13(4-6-18(19)23-2)10-14-8-9-25-17-7-5-15(21)12-16(17)20(14)22/h4-7,10-12H,3,8-9H2,1-2H3/b14-10+ |
| InChIKey | VKPFHYRZMYALMF-GXDHUFHOSA-N |
| XLogP | 4.28 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|