C19H15BrFNO4 — CID 42489201
(2-bromo-4-fluorophenyl)methyl (E)-3-[4-(cyanomethoxy)-3-methoxyphenyl]prop-2-enoate (PubChem CID 42489201) has the molecular formula C19H15BrFNO4 and a molecular weight of 420.23 g/mol. Its IUPAC name is (2-bromo-4-fluorophenyl)methyl (E)-3-[4-(cyanomethoxy)-3-methoxyphenyl]prop-2-enoate.
| Compound Name | (2-bromo-4-fluorophenyl)methyl (E)-3-[4-(cyanomethoxy)-3-methoxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 42489201 |
| Molecular Formula | C19H15BrFNO4 |
| Molecular Weight | 420.23 g/mol |
| Exact Mass | 419.02 |
| IUPAC Name | (2-bromo-4-fluorophenyl)methyl (E)-3-[4-(cyanomethoxy)-3-methoxyphenyl]prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)OCc2ccc(F)cc2Br)ccc1OCC#N |
| InChI | InChI=1S/C19H15BrFNO4/c1-24-18-10-13(2-6-17(18)25-9-8-22)3-7-19(23)26-12-14-4-5-15(21)11-16(14)20/h2-7,10-11H,9,12H2,1H3/b7-3+ |
| InChIKey | MNVMCTZDLQTRMP-XVNBXDOJSA-N |
| XLogP | 4.26 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.23 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|