C22H30N2O4S — CID 7377500
(5E)-2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-5-[[3-methoxy-4-(3-methylbutoxy)phenyl]methylidene]-1,3-thiazol-4-one (PubChem CID 7377500) has the molecular formula C22H30N2O4S and a molecular weight of 418.56 g/mol. Its IUPAC name is (5E)-2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-5-[[3-methoxy-4-(3-methylbutoxy)phenyl]methylidene]-1,3-thiazol-4-one.
| Compound Name | (5E)-2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-5-[[3-methoxy-4-(3-methylbutoxy)phenyl]methylidene]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 7377500 |
| Molecular Formula | C22H30N2O4S |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | (5E)-2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-5-[[3-methoxy-4-(3-methylbutoxy)phenyl]methylidene]-1,3-thiazol-4-one |
| SMILES | COc1cc(/C=C2/SC(N3C[C@H](C)O[C@@H](C)C3)=NC2=O)ccc1OCCC(C)C |
| InChI | InChI=1S/C22H30N2O4S/c1-14(2)8-9-27-18-7-6-17(10-19(18)26-5)11-20-21(25)23-22(29-20)24-12-15(3)28-16(4)13-24/h6-7,10-11,14-16H,8-9,12-13H2,1-5H3/b20-11+/t15-,16-/m0/s1 |
| InChIKey | DJCRMLYXXYCYKK-KJJXXWTESA-N |
| XLogP | 4.20 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|