C18H22N2O4S — CID 7348823
(5E)-2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-5-[(3-ethoxy-4-hydroxyphenyl)methylidene]-1,3-thiazol-4-one (PubChem CID 7348823) has the molecular formula C18H22N2O4S and a molecular weight of 362.45 g/mol. Its IUPAC name is (5E)-2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-5-[(3-ethoxy-4-hydroxyphenyl)methylidene]-1,3-thiazol-4-one.
| Compound Name | (5E)-2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-5-[(3-ethoxy-4-hydroxyphenyl)methylidene]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 7348823 |
| Molecular Formula | C18H22N2O4S |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | (5E)-2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-5-[(3-ethoxy-4-hydroxyphenyl)methylidene]-1,3-thiazol-4-one |
| SMILES | CCOc1cc(/C=C2/SC(N3C[C@H](C)O[C@@H](C)C3)=NC2=O)ccc1O |
| InChI | InChI=1S/C18H22N2O4S/c1-4-23-15-7-13(5-6-14(15)21)8-16-17(22)19-18(25-16)20-9-11(2)24-12(3)10-20/h5-8,11-12,21H,4,9-10H2,1-3H3/b16-8+/t11-,12-/m0/s1 |
| InChIKey | WAZRDVHQZAAHNT-HELSFGJNSA-N |
| XLogP | 2.87 |
| TPSA | 71.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|